|
CAS#: 81050-08-0 Product: Dipropyl 2,2'-disulfanediyldibenzoate No suppilers available for the product. |
| Name | Dipropyl 2,2'-disulfanediyldibenzoate |
|---|---|
| Synonyms | dipropyl 2,2'-dithiobisbenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22O4S2 |
| Molecular Weight | 390.52 |
| CAS Registry Number | 81050-08-0 |
| EINECS | 279-679-2 |
| SMILES | CCCOC(=O)c2ccccc2SSc1ccccc1C(=O)OCCC |
| InChI | 1S/C20H22O4S2/c1-3-13-23-19(21)15-9-5-7-11-17(15)25-26-18-12-8-6-10-16(18)20(22)24-14-4-2/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | HPBZTACBXGMLBZ-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.573°C at 760 mmHg (Cal.) |
| Flash point | 234.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipropyl 2,2'-disulfanediyldibenzoate |