|
CAS#: 81078-23-1 Product: 8-Chloro-1-Phenyl-3H-2-Benzazepine 2-Oxide No suppilers available for the product. |
| Name | 8-Chloro-1-Phenyl-3H-2-Benzazepine 2-Oxide |
|---|---|
| Synonyms | 8-Chlor-1-Phenyl-3H-2-Benzazepin-2-Oxid [German]; 8-Chloro-1-Phenyl-3H-2-Benzazepine 2-Oxide; 3H-2-Benzazepine, 8-Chloro-1-Phenyl-, 2-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.73 |
| CAS Registry Number | 81078-23-1 |
| SMILES | C1=C(Cl)C=CC2=C1C(=[N+]([O-])CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C16H12ClNO/c17-14-9-8-12-7-4-10-18(19)16(15(12)11-14)13-5-2-1-3-6-13/h1-9,11H,10H2 |
| InChIKey | MMAZIPBCTHYOBH-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.751°C at 760 mmHg (Cal.) |
| Flash point | 223.987°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Chloro-1-Phenyl-3H-2-Benzazepine 2-Oxide |