|
CAS#: 81112-43-8 Product: Retinyl Bromoacetate No suppilers available for the product. |
| Name | Retinyl Bromoacetate |
|---|---|
| Synonyms | 2-Bromoacetic Acid [(2Z,4E,6Z,8Z)-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenyl] Ester; [(2Z,4E,6Z,8Z)-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenyl] 2-Bromoethanoate; Retinol, Bromoacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C22H31BrO2 |
| Molecular Weight | 407.39 |
| CAS Registry Number | 81112-43-8 |
| SMILES | C(OC(=O)CBr)\C=C(/C=C/C=C(\C=C/C1=C(CCCC1(C)C)C)C)C |
| InChI | 1S/C22H31BrO2/c1-17(8-6-9-18(2)13-15-25-21(24)16-23)11-12-20-19(3)10-7-14-22(20,4)5/h6,8-9,11-13H,7,10,14-16H2,1-5H3/b9-6+,12-11-,17-8-,18-13- |
| InChIKey | OZTFYHFIAWNXSH-VWYWDUBQSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.516°C at 760 mmHg (Cal.) |
| Flash point | 246.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Retinyl Bromoacetate |