Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,4-Dihydroxy-2,4-Dimethyl-6-Oxo-3-Piperidinecarboxamide |
|---|---|
| Synonyms | 2,4-Dihydroxy-2,4-Dimethyl-6-Oxo-Piperidine-3-Carboxamide; 2,4-Dihydroxy-2,4-Dimethyl-6-Oxo-3-Piperidinecarboxamide; 2,4-Dihydroxy-6-Keto-2,4-Dimethyl-Nipecotamide |
| Molecular Structure |  |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 81124-62-1 |
| EINECS | 279-692-3 |
| SMILES | CC1(O)NC(=O)CC(O)(C1C(=O)N)C |
| InChI | 1S/C8H14N2O4/c1-7(13)3-4(11)10-8(2,14)5(7)6(9)12/h5,13-14H,3H2,1-2H3,(H2,9,12)(H,10,11) |
| InChIKey | OZXMSSBJQZYMRO-UHFFFAOYSA-N |
| Desity | 1.364g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.096°C at 760 mmHg (Cal.) |
| Flash point | 298.583°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dihydroxy-2,4-Dimethyl-6-Oxo-3-Piperidinecarboxamide |