|
CAS#: 811443-27-3 Product: 3-Aminotricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid No suppilers available for the product. |
| Name | 3-Aminotricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid |
|---|---|
| Synonyms | 3-aminotricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 811443-27-3 |
| SMILES | O=C(O)C21CC3C(N)(C(=O)O)C1C2C3 |
| InChI | 1S/C9H11NO4/c10-9(7(13)14)3-1-4-5(9)8(4,2-3)6(11)12/h3-5H,1-2,10H2,(H,11,12)(H,13,14) |
| InChIKey | KETJIAAJBCULKI-UHFFFAOYSA-N |
| Density | 1.769g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.178°C at 760 mmHg (Cal.) |
| Flash point | 188.563°C (Cal.) |
| Refractive index | 1.718 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Aminotricyclo[2.2.1.02,6]heptane-1,3-dicarboxylic acid |