|
CAS#: 81214-88-2 Product: 5-Bromo-4-Oxo-2-Phenylhexanoic Acid No suppilers available for the product. |
| Name | 5-Bromo-4-Oxo-2-Phenylhexanoic Acid |
|---|---|
| Synonyms | 5-Bromo-4-Oxo-2-Phenyl-Hexanoic Acid; 5-Bromo-4-Keto-2-Phenyl-Hexanoic Acid; 5-Boph |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 |
| CAS Registry Number | 81214-88-2 |
| SMILES | C1=CC=CC=C1C(C(=O)O)CC(C(C)Br)=O |
| InChI | 1S/C12H13BrO3/c1-8(13)11(14)7-10(12(15)16)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,15,16) |
| InChIKey | DNDCKTJRGLMEAR-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.734°C at 760 mmHg (Cal.) |
| Flash point | 191.924°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-4-Oxo-2-Phenylhexanoic Acid |