|
CAS#: 81221-85-4 Product: 1-(6,6-Dimethylbicyclo[3.1.0]hex-2-en-2-yl)-4-penten-1-one No suppilers available for the product. |
| Name | 1-(6,6-Dimethylbicyclo[3.1.0]hex-2-en-2-yl)-4-penten-1-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 81221-85-4 |
| EINECS | 279-708-9 |
| SMILES | CC2(C)C1C(=C\CC12)/C(=O)CCC=C |
| InChI | 1S/C13H18O/c1-4-5-6-11(14)9-7-8-10-12(9)13(10,2)3/h4,7,10,12H,1,5-6,8H2,2-3H3 |
| InChIKey | KDIUVWJESDSKRW-UHFFFAOYSA-N |
| Density | 0.986g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.578°C at 760 mmHg (Cal.) |
| Flash point | 105.857°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(6,6-Dimethylbicyclo[3.1.0]hex-2-en-2-yl)-4-penten-1-one |