|
CAS#: 81265-77-2 Product: 4-(4-(2H-Indazol-2-Yl)Phenyl)-2-Butanone No suppilers available for the product. |
| Name | 4-(4-(2H-Indazol-2-Yl)Phenyl)-2-Butanone |
|---|---|
| Synonyms | 4-[4-(2-Indazolyl)Phenyl]Butan-2-One; 2-Butanone, 4-(4-(2H-Indazol-2-Yl)Phenyl)-; 4-(4-(2H-Indazol-2-Yl)Phenyl)-2-Butanone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 |
| CAS Registry Number | 81265-77-2 |
| SMILES | C1=CC(=CC=C1CCC(C)=O)[N]2N=C3C(=C2)C=CC=C3 |
| InChI | 1S/C17H16N2O/c1-13(20)6-7-14-8-10-16(11-9-14)19-12-15-4-2-3-5-17(15)18-19/h2-5,8-12H,6-7H2,1H3 |
| InChIKey | MQQAYMHKAVHXHM-UHFFFAOYSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.903°C at 760 mmHg (Cal.) |
| Flash point | 156.949°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-(2H-Indazol-2-Yl)Phenyl)-2-Butanone |