|
CAS#: 81308-36-3 Product: Methyl N-(benzyloxy)-N-methoxy-2-methylalaninate No suppilers available for the product. |
| Name | Methyl N-(benzyloxy)-N-methoxy-2-methylalaninate |
|---|---|
| Synonyms | Methyl 2-[(benzyloxy)(methoxy)amino]-2-methylpropanoate #; Methyl 2-methyl-2-(methoxy-benzyloxy)amino-propanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.29 |
| CAS Registry Number | 81308-36-3 |
| SMILES | O=C(OC)C(N(OCc1ccccc1)OC)(C)C |
| InChI | 1S/C13H19NO4/c1-13(2,12(15)16-3)14(17-4)18-10-11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | XGGGAMGLLHFEGE-UHFFFAOYSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.802°C at 760 mmHg (Cal.) |
| Flash point | 142.978°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-(benzyloxy)-N-methoxy-2-methylalaninate |