|
CAS#: 81381-67-1 Product: Sanggenon B No suppilers available for the product. |
| Name | Sanggenon B |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C33H30O9 |
| Molecular Weight | 570.59 |
| CAS Registry Number | 81381-67-1 |
| SMILES | C4=C3C2(OC1=CC(=C(C(=C1C(=O)C2(OC3=CC(=C4)O)CC=C(C)C)O)C5=CC6(OC7=C(C(C5)C6)C=CC(=C7)O)C)O)O |
| InChI | 1S/C33H30O9/c1-16(2)8-9-32-30(38)28-26(42-33(32,39)22-7-5-20(35)12-25(22)41-32)13-23(36)27(29(28)37)18-10-17-14-31(3,15-18)40-24-11-19(34)4-6-21(17)24/h4-8,11-13,15,17,34-37,39H,9-10,14H2,1-3H3 |
| InChIKey | UIIUFSXWGFBRFW-UHFFFAOYSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 830.772°C at 760 mmHg (Cal.) |
| Flash point | 273.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sanggenon B |