|
CAS#: 814-16-4 Product: Diethyl (3,3-Dimethyl-2-Oxobutyl)Phosphonate No suppilers available for the product. |
| Name | Diethyl (3,3-Dimethyl-2-Oxobutyl)Phosphonate |
|---|---|
| Synonyms | 1-Diethoxyphosphoryl-3,3-Dimethyl-Butan-2-One; Zinc01845680; Diethyl (3,3-Dimethyl-2-Oxobutyl)Phosphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21O4P |
| Molecular Weight | 236.25 |
| CAS Registry Number | 814-16-4 |
| EINECS | 212-393-8 |
| SMILES | C(C(C(C)(C)C)=O)[P](OCC)(OCC)=O |
| InChI | 1S/C10H21O4P/c1-6-13-15(12,14-7-2)8-9(11)10(3,4)5/h6-8H2,1-5H3 |
| InChIKey | LOUZJUCIRJMGHZ-UHFFFAOYSA-N |
| Density | 1.038g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.082°C at 760 mmHg (Cal.) |
| Flash point | 150.971°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl (3,3-Dimethyl-2-Oxobutyl)Phosphonate |