|
CAS#: 81425-78-7 Product: 8-Methoxycoumarsabin No suppilers available for the product. |
| Name | 8-Methoxycoumarsabin |
|---|---|
| Synonyms | 4,7,8-Trimethoxy-3,5-Dimethyl-Chromen-2-One; 4,7,8-Trimethoxy-3,5-Dimethyl-2-Chromenone; 4,7,8-Trimethoxy-3,5-Dimethyl-Coumarin |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 |
| CAS Registry Number | 81425-78-7 |
| SMILES | C1=C(C2=C(C(=C1OC)OC)OC(C(=C2OC)C)=O)C |
| InChI | 1S/C14H16O5/c1-7-6-9(16-3)12(18-5)13-10(7)11(17-4)8(2)14(15)19-13/h6H,1-5H3 |
| InChIKey | PKKTXAMCHLIVDS-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.183°C at 760 mmHg (Cal.) |
| Flash point | 198.796°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methoxycoumarsabin |