|
CAS#: 81456-46-4 Product: (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl valerate No suppilers available for the product. |
| Name | (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl valerate |
|---|---|
| Synonyms | 11β,17,21 |
| Molecular Structure | ![]() |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.61 |
| CAS Registry Number | 81456-46-4 |
| EINECS | 279-764-4 |
| SMILES | CC(=O)OCC(=O)[C@]2(CC[C@H]1[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C)OC(=O)CCCC |
| InChI | 1S/C28H40O7/c1-5-6-7-24(33)35-28(23(32)16-34-17(2)29)13-11-21-20-9-8-18-14-19(30)10-12-26(18,3)25(20)22(31)15-27(21,28)4/h14,20-22,25,31H,5-13,15-16H2,1-4H3/t20-,21-,22-,25+,26-,27-,28-/m0/s1 |
| InChIKey | YHLNSTMFAGIHSR-SLPNHVECSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.874°C at 760 mmHg (Cal.) |
| Flash point | 194.722°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (11beta)-21-Acetoxy-11-hydroxy-3,20-dioxopregn-4-en-17-yl valerate |