|
CAS#: 815-62-3 Product: N,N,N',N'-Tetramethylethene-1,1-Diamine No suppilers available for the product. |
| Name | N,N,N',N'-Tetramethylethene-1,1-Diamine |
|---|---|
| Synonyms | 1-Dimethylaminovinyl-Dimethyl-Amine; 1,1-Ethenediamine, N,N,N',N'-Tetramethyl-; Inchi=1/C6h14n2/C1-6(7(2)3)8(4)5/H1h2,2-5H |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 |
| CAS Registry Number | 815-62-3 |
| SMILES | CN(C(=C)N(C)C)C |
| InChI | 1S/C6H14N2/c1-6(7(2)3)8(4)5/h1H2,2-5H3 |
| InChIKey | IRZPOGNEUZKUTG-UHFFFAOYSA-N |
| Density | 0.834g/cm3 (Cal.) |
|---|---|
| Boiling point | 154.123°C at 760 mmHg (Cal.) |
| Flash point | 39.071°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,N',N'-Tetramethylethene-1,1-Diamine |