|
CAS#: 81518-31-2 Product: 3-(2-Chlorophenyl)-4-Phenyl-5-(2-Propenylthio)-4H-1,2,4-Triazole No suppilers available for the product. |
| Name | 3-(2-Chlorophenyl)-4-Phenyl-5-(2-Propenylthio)-4H-1,2,4-Triazole |
|---|---|
| Synonyms | 3-Allylsulfanyl-5-(2-Chlorophenyl)-4-Phenyl-1,2,4-Triazole; 3-(Allylthio)-5-(2-Chlorophenyl)-4-Phenyl-1,2,4-Triazole; 3-(2-Chlorophenyl)-4-Phenyl-5-(2-Propenylthio)-4H-1,2,4-Triazole |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14ClN3S |
| Molecular Weight | 327.83 |
| CAS Registry Number | 81518-31-2 |
| SMILES | C1=CC=CC=C1[N]2C(=NN=C2SCC=C)C3=C(Cl)C=CC=C3 |
| InChI | 1S/C17H14ClN3S/c1-2-12-22-17-20-19-16(14-10-6-7-11-15(14)18)21(17)13-8-4-3-5-9-13/h2-11H,1,12H2 |
| InChIKey | KDPVCRXZJIMMRT-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.316°C at 760 mmHg (Cal.) |
| Flash point | 259.406°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Chlorophenyl)-4-Phenyl-5-(2-Propenylthio)-4H-1,2,4-Triazole |