|
CAS#: 81542-83-8 Product: 4-Fluorophenyl Methylphenylphosphinate No suppilers available for the product. |
| Name | 4-Fluorophenyl Methylphenylphosphinate |
|---|---|
| Synonyms | 1-Fluoro-4-(Methyl-Phenyl-Phosphoryl)Oxy-Benzene; 4-Fluorophenyl Methylphenylphosphinate; Phosphinic Acid, Methylphenyl-, 4-Fluorophenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12FO2P |
| Molecular Weight | 250.21 |
| CAS Registry Number | 81542-83-8 |
| SMILES | C1=CC=CC=C1[P](=O)(OC2=CC=C(C=C2)F)C |
| InChI | 1S/C13H12FO2P/c1-17(15,13-5-3-2-4-6-13)16-12-9-7-11(14)8-10-12/h2-10H,1H3 |
| InChIKey | AJBBGWBRYYUSBL-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.823°C at 760 mmHg (Cal.) |
| Flash point | 157.505°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluorophenyl Methylphenylphosphinate |