|
CAS#: 81671-46-7 Product: 2,2,2-Trifluoro-1-[1,1,1,3,3,3-hexamethyl-2-(trimethylsilyl)-2-trisilanyl]ethanone No suppilers available for the product. |
| Name | 2,2,2-Trifluoro-1-[1,1,1,3,3,3-hexamethyl-2-(trimethylsilyl)-2-trisilanyl]ethanone |
|---|---|
| Synonyms | 1,1,1,3,3 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H27F3OSi4 |
| Molecular Weight | 344.67 |
| CAS Registry Number | 81671-46-7 |
| SMILES | FC(F)(F)C(=O)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | 1S/C11H27F3OSi4/c1-16(2,3)19(17(4,5)6,18(7,8)9)10(15)11(12,13)14/h1-9H3 |
| InChIKey | YZPBGNQKCOMGON-UHFFFAOYSA-N |
| Density | 0.94g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.643°C at 760 mmHg (Cal.) |
| Flash point | 97.523°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trifluoro-1-[1,1,1,3,3,3-hexamethyl-2-(trimethylsilyl)-2-trisilanyl]ethanone |