|
CAS#: 81705-01-3 Product: Tricresyl Ethyl Phthalate No suppilers available for the product. |
| Name | Tricresyl Ethyl Phthalate |
|---|---|
| Synonyms | Benzene-1,2-Dicarboxylic Acid O2-Ethyl O1-(2-Methylphenyl) Ester; 1,2-Benzenedicarboxylic Acid, Ethyl Methylphenyl Ester; Tricresyl Ethyl Phthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 |
| CAS Registry Number | 81705-01-3 |
| SMILES | C1=C(C(=CC=C1)C(OCC)=O)C(OC2=CC=CC=C2C)=O |
| InChI | 1S/C17H16O4/c1-3-20-16(18)13-9-5-6-10-14(13)17(19)21-15-11-7-4-8-12(15)2/h4-11H,3H2,1-2H3 |
| InChIKey | SYIXLSSBCKQAAT-UHFFFAOYSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.268°C at 760 mmHg (Cal.) |
| Flash point | 228.603°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tricresyl Ethyl Phthalate |