Online Database of Chemicals from Around the World
|
CAS#: 81761-20-8 Product: N-(2-Ethyl-6-Methylphenyl)-3-Oxobutyramide No suppilers available for the product. |
| Name | N-(2-Ethyl-6-Methylphenyl)-3-Oxobutyramide |
|---|---|
| Synonyms | N-(2-Ethyl-6-Methyl-Phenyl)-3-Oxo-Butanamide; N-(2-Ethyl-6-Methyl-Phenyl)-3-Keto-Butyramide; N-(2-Ethyl-6-Methylphenyl)-3-Oxobutyramide |
| Molecular Structure |  |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 81761-20-8 |
| EINECS | 279-812-4 |
| SMILES | C1=CC=C(C(=C1CC)NC(=O)CC(=O)C)C |
| InChI | 1S/C13H17NO2/c1-4-11-7-5-6-9(2)13(11)14-12(16)8-10(3)15/h5-7H,4,8H2,1-3H3,(H,14,16) |
| InChIKey | TXIFNAIHABCDSX-UHFFFAOYSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.64°C at 760 mmHg (Cal.) |
| Flash point | 146.975°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Ethyl-6-Methylphenyl)-3-Oxobutyramide |