|
CAS#: 81787-06-6 Product: 3,5,6,6-Tetramethyl-4-methylene-2-heptanolato No suppilers available for the product. |
| Name | 3,5,6,6-Tetramethyl-4-methylene-2-heptanolato |
|---|---|
| Synonyms | Kohinool |
| Molecular Structure | ![]() |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 |
| CAS Registry Number | 81787-06-6 |
| SMILES | CC(C)(C)C(C)C(=C)C(C)C(C)O |
| InChI | 1S/C12H24O/c1-8(9(2)11(4)13)10(3)12(5,6)7/h9-11,13H,1H2,2-7H3 |
| InChIKey | KQHNSYOQXVRMSX-UHFFFAOYSA-N |
| Density | 0.837g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.518°C at 760 mmHg (Cal.) |
| Flash point | 80.499°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,6,6-Tetramethyl-4-methylene-2-heptanolato |