|
CAS#: 81831-81-4 Product: [1-(1,1-Dimethylethyl)-4-Hydroxy-4-Phenylpiperidin-3-Yl] Phenyl Ketone No suppilers available for the product. |
| Name | [1-(1,1-Dimethylethyl)-4-Hydroxy-4-Phenylpiperidin-3-Yl] Phenyl Ketone |
|---|---|
| Synonyms | (1-Tert-Butyl-4-Hydroxy-4-Phenyl-3-Piperidyl)-Phenyl-Methanone; (1-Tert-Butyl-4-Hydroxy-4-Phenyl-3-Piperidinyl)-Phenylmethanone; (1-Tert-Butyl-4-Hydroxy-4-Phenyl-Piperidin-3-Yl)-Phenyl-Methanone |
| Molecular Structure | ![]() |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 |
| CAS Registry Number | 81831-81-4 |
| EINECS | 279-834-4 |
| SMILES | C1=CC=CC=C1C3(O)C(C(=O)C2=CC=CC=C2)CN(C(C)(C)C)CC3 |
| InChI | 1S/C22H27NO2/c1-21(2,3)23-15-14-22(25,18-12-8-5-9-13-18)19(16-23)20(24)17-10-6-4-7-11-17/h4-13,19,25H,14-16H2,1-3H3 |
| InChIKey | KXNGXWRDUHMYHK-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.134°C at 760 mmHg (Cal.) |
| Flash point | 250.224°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1-(1,1-Dimethylethyl)-4-Hydroxy-4-Phenylpiperidin-3-Yl] Phenyl Ketone |