|
CAS#: 819-73-8 Product: Lead Dibutyrate No suppilers available for the product. |
| Name | Lead Dibutyrate |
|---|---|
| Synonyms | Plumbous Butanoate; Plumbous Butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14O4Pb |
| Molecular Weight | 381.40 |
| CAS Registry Number | 819-73-8 |
| EINECS | 212-462-2 |
| SMILES | C(C([O-])=O)CC.C(C([O-])=O)CC.[Pb++] |
| InChI | 1S/2C4H8O2.Pb/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | ZFBGUXUJXUFOLU-UHFFFAOYSA-L |
| Boiling point | 164.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 69.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lead Dibutyrate |