|
CAS#: 81910-07-8 Product: Pyrrolomycin D No suppilers available for the product. |
| Name | Pyrrolomycin D |
|---|---|
| Synonyms | (3,5-Dichloro-2-Hydroxy-Phenyl)-(3,4,5-Trichloro-1H-Pyrrol-2-Yl)Methanone; (3,5-Dichloro-2-Hydroxyphenyl)(3,4,5-Trichloro-1H-Pyrrol-2-Yl)Methanone; Antibiotic Sf 2080D |
| Molecular Structure | ![]() |
| Molecular Formula | C11H4Cl5NO2 |
| Molecular Weight | 359.42 |
| CAS Registry Number | 81910-07-8 |
| SMILES | C2=C(C(=O)C1=C(Cl)C(=C(Cl)[NH]1)Cl)C(=C(Cl)C=C2Cl)O |
| InChI | 1S/C11H4Cl5NO2/c12-3-1-4(9(18)5(13)2-3)10(19)8-6(14)7(15)11(16)17-8/h1-2,17-18H |
| InChIKey | IJODRMYZNYTFTC-UHFFFAOYSA-N |
| Density | 1.761g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.923°C at 760 mmHg (Cal.) |
| Flash point | 257.959°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyrrolomycin D |