|
CAS#: 81943-52-4 Product: 5,3',4'-Trihydroxy-3,6,7,8-Tetramethoxyflavone No suppilers available for the product. |
| Name | 5,3',4'-Trihydroxy-3,6,7,8-Tetramethoxyflavone |
|---|---|
| Synonyms | 2-(3,4-Dihydroxyphenyl)-5-Hydroxy-3,6,7,8-Tetramethoxy-Chromen-4-One; 2-(3,4-Dihydroxyphenyl)-5-Hydroxy-3,6,7,8-Tetramethoxy-4-Chromenone; 2-(3,4-Dihydroxyphenyl)-5-Hydroxy-3,6,7,8-Tetramethoxy-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18O9 |
| Molecular Weight | 390.35 |
| CAS Registry Number | 81943-52-4 |
| SMILES | C1=C(O)C(=CC=C1C2=C(C(C3=C(O2)C(=C(C(=C3O)OC)OC)OC)=O)OC)O |
| InChI | 1S/C19H18O9/c1-24-16-12(22)11-13(23)17(25-2)19(27-4)18(26-3)15(11)28-14(16)8-5-6-9(20)10(21)7-8/h5-7,20-21,23H,1-4H3 |
| InChIKey | WQDGAXUSPJAKPY-UHFFFAOYSA-N |
| Density | 1.528g/cm3 (Cal.) |
|---|---|
| Boiling point | 687.768°C at 760 mmHg (Cal.) |
| Flash point | 248.872°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,3',4'-Trihydroxy-3,6,7,8-Tetramethoxyflavone |