|
CAS#: 82-65-5 Product: 2H-Naphth[1,8-cd]Isothiazole-3,5-Disulphonic Acid 1,1-Dioxide No suppilers available for the product. |
| Name | 2H-Naphth[1,8-cd]Isothiazole-3,5-Disulphonic Acid 1,1-Dioxide |
|---|---|
| Synonyms | 2H-Naphth(1,8-Cd)Isothiazole-3,5-Disulphonic Acid 1,1-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7NO8S3 |
| Molecular Weight | 365.35 |
| CAS Registry Number | 82-65-5 |
| EINECS | 201-432-4 |
| SMILES | C2=C(C3=C1C(=CC=CC1=C2[S](=O)(=O)O)[S](=O)(=O)N3)[S](=O)(=O)O |
| InChI | 1S/C10H7NO8S3/c12-20(13)6-3-1-2-5-7(21(14,15)16)4-8(22(17,18)19)10(11-20)9(5)6/h1-4,11H,(H,14,15,16)(H,17,18,19) |
| InChIKey | SOEOLOYSOQPCII-UHFFFAOYSA-N |
| Density | 1.996g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2H-Naphth[1,8-cd]Isothiazole-3,5-Disulphonic Acid 1,1-Dioxide |