| Cayman Chemical Company | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Name | 8-Oxyguanine |
|---|---|
| Synonyms | 2-Amino-3H-Purine-6,8-Quinone; Chebi:44605; 8-Oxoguanine |
| Molecular Structure | ![]() |
| Molecular Formula | C5H3N5O2 |
| Molecular Weight | 165.11 |
| CAS Registry Number | 82014-86-6 |
| SMILES | O=C1N=C(NC2=NC(=O)N=C12)N |
| InChI | 1S/C5H3N5O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h(H3,6,8,9,10,11,12) |
| InChIKey | UBKVUFQGVWHZIR-UHFFFAOYSA-N |
| Density | 2.495g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.691°C at 760 mmHg (Cal.) |
| Flash point | 151.982°C (Cal.) |
| (1) | Davis Jeffery T.. Supramolecular architectures generated by self-assembly of guanosine derivatives, Chemical Society Reviews, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 8-Oxyguanine |