|
CAS#: 82030-42-0 Product: 1,3,5-Triaza-1,3,5-trinitrocyclohexane No suppilers available for the product. |
| Name | 1,3,5-Triaza-1,3,5-trinitrocyclohexane |
|---|---|
| Synonyms | C0639; Trinitrohexahydrotriazine; Chebi:24556 |
| Molecular Structure | ![]() |
| Molecular Formula | C3H6N6O6 |
| Molecular Weight | 222.12 |
| CAS Registry Number | 82030-42-0 |
| SMILES | O=[N+]([O-])N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 |
| InChI | 1S/C3H6N6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H2 |
| InChIKey | XTFIVUDBNACUBN-UHFFFAOYSA-N |
| Density | 1.898g/cm3 (Cal.) |
|---|---|
| Melting point | 205°C (Expl.) |
| Boiling point | 747.027°C at 760 mmHg (Cal.) |
| Flash point | 405.588°C (Cal.) |
| solubility | Insoluble |
| Safety Description | Safety glasses, gloves, adequate ventilation. The explosive hazardposed by this chemical probably presents a more significant hazard than other risks to health from its handling; it should not be hand led by untrained workers. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Triaza-1,3,5-trinitrocyclohexane |