|
CAS#: 82049-48-7 Product: S-[4-(Acetylamino)-5-Methyl-4H-1,2,4-Triazol-3-Yl] Ethanethioate No suppilers available for the product. |
| Name | S-[4-(Acetylamino)-5-Methyl-4H-1,2,4-Triazol-3-Yl] Ethanethioate |
|---|---|
| Synonyms | Ethanethioic Acid S-[(4-Acetamido-5-Methyl-1,2,4-Triazol-3-Yl)] Ester; S-(4-(Acetylamino)-5-Methyl-4H-1,2,4-Triazol-3-Yl) Ethanethioate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.24 |
| CAS Registry Number | 82049-48-7 |
| EINECS | 279-894-1 |
| SMILES | CC1=NN=C(SC(=O)C)[N]1NC(=O)C |
| InChI | 1S/C7H10N4O2S/c1-4-8-9-7(14-6(3)13)11(4)10-5(2)12/h1-3H3,(H,10,12) |
| InChIKey | PYDSMPVYGIXTGX-UHFFFAOYSA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for S-[4-(Acetylamino)-5-Methyl-4H-1,2,4-Triazol-3-Yl] Ethanethioate |