|
CAS#: 82085-61-8 Product: 4-Chloro-2-Hydroxyphenylacetic Acid No suppilers available for the product. |
| Name | 4-Chloro-2-Hydroxyphenylacetic Acid |
|---|---|
| Synonyms | 2-(4-Chloro-2-Hydroxy-Phenyl)Acetic Acid; 2-(4-Chloro-2-Hydroxy-Phenyl)Ethanoic Acid; 4-Cl-2-Hpa |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59 |
| CAS Registry Number | 82085-61-8 |
| SMILES | C1=C(C(=CC=C1Cl)CC(=O)O)O |
| InChI | 1S/C8H7ClO3/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4,10H,3H2,(H,11,12) |
| InChIKey | FTGUQEXOEPUPQG-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.143°C at 760 mmHg (Cal.) |
| Flash point | 167.98°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-Hydroxyphenylacetic Acid |