|
CAS#: 82147-51-1 Product: Glutathione Amide No suppilers available for the product. |
| Name | Glutathione Amide |
|---|---|
| Synonyms | (2S)-2-Amino-5-[[2-[[(2R)-2-Amino-3-Sulfanyl-Propanoyl]Amino]Acetyl]Amino]-5-Oxo-Pentanoic Acid; (2S)-2-Amino-5-[[2-[[(2R)-2-Amino-3-Mercapto-1-Oxopropyl]Amino]-1-Oxoethyl]Amino]-5-Oxopentanoic Acid; (2S)-2-Amino-5-[[2-[[(2R)-2-Amino-3-Mercapto-Propanoyl]Amino]Acetyl]Amino]-5-Keto-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N4O5S |
| Molecular Weight | 306.34 |
| CAS Registry Number | 82147-51-1 |
| SMILES | [C@H](C(NCC(=O)NC(CC[C@@H](C(=O)O)N)=O)=O)(N)CS |
| InChI | 1S/C10H18N4O5S/c11-5(10(18)19)1-2-7(15)14-8(16)3-13-9(17)6(12)4-20/h5-6,20H,1-4,11-12H2,(H,13,17)(H,18,19)(H,14,15,16)/t5-,6-/m0/s1 |
| InChIKey | KZUSXYPIOSQMLU-WDSKDSINSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 654.108°C at 760 mmHg (Cal.) |
| Flash point | 349.392°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glutathione Amide |