|
CAS#: 82191-15-9 Product: 2-Imino-alpha-(3-Nitrophenyl)Thiazolidin-3-Ethanol No suppilers available for the product. |
| Name | 2-Imino-alpha-(3-Nitrophenyl)Thiazolidin-3-Ethanol |
|---|---|
| Synonyms | 2-(2-Iminothiazolidin-3-Yl)-1-(3-Nitrophenyl)Ethanol; 2-(2-Imino-3-Thiazolidinyl)-1-(3-Nitrophenyl)Ethanol; 2-Imino-Alpha-(M-Nitrophenyl)Thiazolidin-3-Ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.30 |
| CAS Registry Number | 82191-15-9 |
| EINECS | 279-913-3 |
| SMILES | C2=C(C(O)CN1C(SCC1)=N)C=CC=C2[N+]([O-])=O |
| InChI | 1S/C11H13N3O3S/c12-11-13(4-5-18-11)7-10(15)8-2-1-3-9(6-8)14(16)17/h1-3,6,10,12,15H,4-5,7H2 |
| InChIKey | HUXFDEDCBFPIJQ-UHFFFAOYSA-N |
| Density | 1.506g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.97°C at 760 mmHg (Cal.) |
| Flash point | 224.724°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Imino-alpha-(3-Nitrophenyl)Thiazolidin-3-Ethanol |