Online Database of Chemicals from Around the World
|
CAS#: 82298-37-1 Product: Benzo(a)Pyrenyl-7-Glucuronide No suppilers available for the product. |
| Name | Benzo(a)Pyrenyl-7-Glucuronide |
|---|---|
| Synonyms | (2S,3S,4S,5R)-6-Benzo[A]Pyren-7-Yloxy-3,4,5-Trihydroxy-Tetrahydropyran-2-Carboxylic Acid; (2S,3S,4S,5R)-6-(7-Benzo[A]Pyrenyloxy)-3,4,5-Trihydroxy-2-Tetrahydropyrancarboxylic Acid; (2S,3S,4S,5R)-6-Benzo[A]Pyren-7-Yloxy-3,4,5-Trihydroxy-Oxane-2-Carboxylic Acid |
| Molecular Structure |  |
| Molecular Formula | C26H20O7 |
| Molecular Weight | 444.44 |
| CAS Registry Number | 82298-37-1 |
| SMILES | [C@H]6(O)C(OC1=C3C(=CC=C1)C2=CC=C5C4=C2C(=C3)C=CC4=CC=C5)O[C@@H]([C@@H](O)[C@@H]6O)C(=O)O |
| InChI | 1S/C26H20O7/c27-21-22(28)24(25(30)31)33-26(23(21)29)32-18-6-2-5-15-16-10-9-13-4-1-3-12-7-8-14(11-17(15)18)20(16)19(12)13/h1-11,21-24,26-29H,(H,30,31)/t21-,22-,23+,24-,26?/m0/s1 |
| InChIKey | PARRUFHTMWAUMD-BFZHNPFYSA-N |
| Density | 1.605g/cm3 (Cal.) |
|---|---|
| Boiling point | 785.344°C at 760 mmHg (Cal.) |
| Flash point | 275.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(a)Pyrenyl-7-Glucuronide |