|
CAS#: 82412-15-5 Product: 7-Anilinocoumarin-4-Acetic Acid No suppilers available for the product. |
| Name | 7-Anilinocoumarin-4-Acetic Acid |
|---|---|
| Synonyms | 2-[2-Oxo-7-(Phenylamino)-4-Chromenyl]Acetic Acid; 2-[2-Keto-7-(Phenylamino)Chromen-4-Yl]Acetic Acid; 2-[2-Oxo-7-(Phenylamino)Chromen-4-Yl]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 |
| CAS Registry Number | 82412-15-5 |
| SMILES | C1=C3C(=CC=C1NC2=CC=CC=C2)C(=CC(O3)=O)CC(=O)O |
| InChI | 1S/C17H13NO4/c19-16(20)8-11-9-17(21)22-15-10-13(6-7-14(11)15)18-12-4-2-1-3-5-12/h1-7,9-10,18H,8H2,(H,19,20) |
| InChIKey | CSPJQOJRUAXBGR-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 545.517°C at 760 mmHg (Cal.) |
| Flash point | 283.719°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Anilinocoumarin-4-Acetic Acid |