|
CAS#: 824397-72-0 Product: 3-Amino-5-[(4-ethylphenyl)amino]-1H-pyrazole-4-carbonitrile No suppilers available for the product. |
| Name | 3-Amino-5-[(4-ethylphenyl)amino]-1H-pyrazole-4-carbonitrile |
|---|---|
| Synonyms | 1H-Pyrazo |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 |
| CAS Registry Number | 824397-72-0 |
| SMILES | CCc1ccc(cc1)Nc2c(c(n[nH]2)N)C#N |
| InChI | 1S/C12H13N5/c1-2-8-3-5-9(6-4-8)15-12-10(7-13)11(14)16-17-12/h3-6H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | PXGJIKLRIUXXRJ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 255.0±28.7°C (Cal.) |
| Refractive index | 1.651 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-5-[(4-ethylphenyl)amino]-1H-pyrazole-4-carbonitrile |