|
CAS#: 82499-18-1 Product: 2-Ethoxy-N-(purin-6-yl)ethanesulfonamide No suppilers available for the product. |
| Name | 2-Ethoxy-N-(purin-6-yl)ethanesulfonamide |
|---|---|
| Synonyms | 1H-Purine-6-Sulfonamide, N-(2-Ethoxyethyl)-; Nsc62389; Pd 158 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N5O3S |
| Molecular Weight | 271.29 |
| CAS Registry Number | 82499-18-1 |
| SMILES | C2=NC1=C(C(=NC=N1)[S](=O)(NCCOCC)=O)[NH]2 |
| InChI | 1S/C9H13N5O3S/c1-2-17-4-3-14-18(15,16)9-7-8(11-5-10-7)12-6-13-9/h5-6,14H,2-4H2,1H3,(H,10,11,12,13) |
| InChIKey | UMMSDMIIDBQULQ-UHFFFAOYSA-N |
| Density | 1.443g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.278°C at 760 mmHg (Cal.) |
| Flash point | 295.065°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethoxy-N-(purin-6-yl)ethanesulfonamide |