|
CAS#: 825-76-3 Product: alpha-Cyclopropylstyrene No suppilers available for the product. |
| Name | alpha-Cyclopropylstyrene |
|---|---|
| Synonyms | 1-Cyclopropylvinylbenzene; (1-Cyclopropylvinyl)Benzenato; Inchi=1/C11h12/C1-9(11-7-8-11)10-5-3-2-4-6-10/H2-6,11H,1,7-8H |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 |
| CAS Registry Number | 825-76-3 |
| EINECS | 212-547-4 |
| SMILES | C2=C(C(C1CC1)=C)C=CC=C2 |
| InChI | 1S/C11H12/c1-9(11-7-8-11)10-5-3-2-4-6-10/h2-6,11H,1,7-8H2 |
| InChIKey | VQBRSCDCSOKQHR-UHFFFAOYSA-N |
| Density | 0.998g/cm3 (Cal.) |
|---|---|
| Boiling point | 214.735°C at 760 mmHg (Cal.) |
| Flash point | 76.778°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Cyclopropylstyrene |