|
CAS#: 82608-90-0 Product: (Z)-3-Chloro-2-Methyl-N-Sulfinyl-Benzenamine No suppilers available for the product. |
| Name | (Z)-3-Chloro-2-Methyl-N-Sulfinyl-Benzenamine |
|---|---|
| Synonyms | Benzenamine, 3-Chloro-2-Methyl-N-Sulfinyl-, (Z)-; 3-Chloro-2-Methyl-N-Sulfinylbenzenamine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClNOS |
| Molecular Weight | 187.64 |
| CAS Registry Number | 82608-90-0 |
| SMILES | [S](=NC1=CC=CC(=C1C)Cl)=O |
| InChI | 1S/C7H6ClNOS/c1-5-6(8)3-2-4-7(5)9-11-10/h2-4H,1H3 |
| InChIKey | WDFSGTRWQNTXKB-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.762°C at 760 mmHg (Cal.) |
| Flash point | 125.415°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (Z)-3-Chloro-2-Methyl-N-Sulfinyl-Benzenamine |