|
CAS#: 827-87-2 Product: 1-(1-Cyclopropylvinyl)-4-Fluorobenzene No suppilers available for the product. |
| Name | 1-(1-Cyclopropylvinyl)-4-Fluorobenzene |
|---|---|
| Synonyms | 1-(1-Cyclopropylvinyl)-4-Fluoro-Benzene; 1-(1-Cyclopropylvinyl)-4-Fluorobenzene; 1-(1-Cyclopropylethenyl)-4-Fluoro-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11F |
| Molecular Weight | 162.21 |
| CAS Registry Number | 827-87-2 |
| EINECS | 212-575-7 |
| SMILES | C2=C(C(C1CC1)=C)C=CC(=C2)F |
| InChI | 1S/C11H11F/c1-8(9-2-3-9)10-4-6-11(12)7-5-10/h4-7,9H,1-3H2 |
| InChIKey | YLAUWEDWRUWPNX-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 214.698°C at 760 mmHg (Cal.) |
| Flash point | 76.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Cyclopropylvinyl)-4-Fluorobenzene |