|
CAS#: 827024-67-9 Product: 4-Methyl-2H,8H-thiopyrano[2,3-h]chromen-2-one No suppilers available for the product. |
| Name | 4-Methyl-2H,8H-thiopyrano[2,3-h]chromen-2-one |
|---|---|
| Synonyms | 2H,8H-Thiopyrano[2,3-h]-1-benzopyran-2-one, 4-methyl-; 4-Methyl-2H,8H-thiopyrano[2,3-h]chromen-2-on; 4-Methyl-2H,8H-thiopyrano[2,3-h]chromen-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.28 |
| CAS Registry Number | 827024-67-9 |
| SMILES | Cc1cc(=O)oc2c1ccc3c2C=CCS3 |
| InChI | 1S/C13H10O2S/c1-8-7-12(14)15-13-9(8)4-5-11-10(13)3-2-6-16-11/h2-5,7H,6H2,1H3 |
| InChIKey | RVFIPJYAMHCRDL-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 226.3±16.7°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-2H,8H-thiopyrano[2,3-h]chromen-2-one |