|
CAS#: 827299-47-8 Product: 4-(2,5-Dimethylphenyl)-3,3-dimethyl-2-butanol No suppilers available for the product. |
| Name | 4-(2,5-Dimethylphenyl)-3,3-dimethyl-2-butanol |
|---|---|
| Synonyms | 4-(2,5-Dimethylphenyl)-3,3-dimethyl-2-butanol; 4-(2,5-Dimethylphenyl)-3,3-dimethyl-2-butanol; 4-(2,5-Diméthylphényl)-3,3-diméthyl-2-butanol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.32 |
| CAS Registry Number | 827299-47-8 |
| SMILES | Cc1ccc(c(c1)CC(C)(C)C(C)O)C |
| InChI | 1S/C14H22O/c1-10-6-7-11(2)13(8-10)9-14(4,5)12(3)15/h6-8,12,15H,9H2,1-5H3 |
| InChIKey | ZHAATQWUNXGHRF-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.7±11.0°C at 760 mmHg (Cal.) |
| Flash point | 118.0±15.1°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,5-Dimethylphenyl)-3,3-dimethyl-2-butanol |