|
CAS#: 82745-72-0 Product: 2-(4-Methylphenyl)Sulfonyloxybenzoic Acid No suppilers available for the product. |
| Name | 2-(4-Methylphenyl)Sulfonyloxybenzoic Acid |
|---|---|
| Synonyms | Nsc75689; Aids-167488; Aids167488 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O5S |
| Molecular Weight | 292.31 |
| CAS Registry Number | 82745-72-0 |
| SMILES | C1=CC(=CC=C1C)[S](=O)(=O)OC2=C(C=CC=C2)C(=O)O |
| InChI | 1S/C14H12O5S/c1-10-6-8-11(9-7-10)20(17,18)19-13-5-3-2-4-12(13)14(15)16/h2-9H,1H3,(H,15,16) |
| InChIKey | DPDKNUJZTCXXLI-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.383°C at 760 mmHg (Cal.) |
| Flash point | 249.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methylphenyl)Sulfonyloxybenzoic Acid |