|
CAS#: 827608-96-8 Product: 2,2,4-Trimethyl-5-(2-phenylethyl)-1,3-dioxolane No suppilers available for the product. |
| Name | 2,2,4-Trimethyl-5-(2-phenylethyl)-1,3-dioxolane |
|---|---|
| Synonyms | 1,3-Dioxolane, 2,2,4-trimethyl-5-(2-phenylethyl)-; 2,2,4-Trimethyl-5-(2-phenylethyl)-1,3-dioxolan; 2,2,4-Trimethyl-5-(2-phenylethyl)-1,3-dioxolane |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 827608-96-8 |
| SMILES | CC1C(OC(O1)(C)C)CCc2ccccc2 |
| InChI | 1S/C14H20O2/c1-11-13(16-14(2,3)15-11)10-9-12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3 |
| InChIKey | KUFNRHHBYQEPTD-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.3±15.0°C at 760 mmHg (Cal.) |
| Flash point | 135.3±16.0°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4-Trimethyl-5-(2-phenylethyl)-1,3-dioxolane |