|
CAS#: 82799-45-9 Product: 2,4-Diethyl-9H-thioxanthen-9-one 10,10-dioxide No suppilers available for the product. |
| Name | 2,4-Diethyl-9H-thioxanthen-9-one 10,10-dioxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.37 |
| CAS Registry Number | 82799-45-9 |
| EINECS | 280-042-6 |
| SMILES | O=C3c1ccccc1S(=O)(=O)c2c3cc(cc2CC)CC |
| InChI | 1S/C17H16O3S/c1-3-11-9-12(4-2)17-14(10-11)16(18)13-7-5-6-8-15(13)21(17,19)20/h5-10H,3-4H2,1-2H3 |
| InChIKey | NKVRNMCFIYCIQS-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.796°C at 760 mmHg (Cal.) |
| Flash point | 328.189°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diethyl-9H-thioxanthen-9-one 10,10-dioxide |