|
CAS#: 828249-45-2 Product: 5,8,10,10-Tetramethyl-6-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene No suppilers available for the product. |
| Name | 5,8,10,10-Tetramethyl-6-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene |
|---|---|
| Synonyms | 5,7-Metha |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 |
| CAS Registry Number | 828249-45-2 |
| SMILES | Cc1ccc2c(n1)C(C3CC2C3(C)C)C |
| InChI | 1S/C14H19N/c1-8-5-6-10-12-7-11(14(12,3)4)9(2)13(10)15-8/h5-6,9,11-12H,7H2,1-4H3 |
| InChIKey | UUGLPRPECXJONI-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.6±9.0°C at 760 mmHg (Cal.) |
| Flash point | 115.9±16.0°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,8,10,10-Tetramethyl-6-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene |