|
CAS#: 82875-68-1 Product: 1,2,3,5,6,7-Hexahydro-N,alpha-Dimethyl-S-Indacene-4-Ethanamine Hydrochloride No suppilers available for the product. |
| Name | 1,2,3,5,6,7-Hexahydro-N,alpha-Dimethyl-S-Indacene-4-Ethanamine Hydrochloride |
|---|---|
| Synonyms | 1-(1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)-N-Methyl-Propan-2-Amine Hydrochloride; [2-(1,2,3,5,6,7-Hexahydro-S-Indacen-4-Yl)-1-Methyl-Ethyl]-Methyl-Amine Hydrochloride; 1,2,3,5,6,7-Hexahydro-N,Alpha-Dimethyl-S-Indacene-4-Ethanamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24ClN |
| Molecular Weight | 265.83 |
| CAS Registry Number | 82875-68-1 |
| SMILES | [H+].C1=C3C(=C(C2=C1CCC2)CC(NC)C)CCC3.[Cl-] |
| InChI | 1S/C16H23N.ClH/c1-11(17-2)9-16-14-7-3-5-12(14)10-13-6-4-8-15(13)16;/h10-11,17H,3-9H2,1-2H3;1H |
| InChIKey | HVBJANMWWGQJOR-UHFFFAOYSA-N |
| Boiling point | 338.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5,6,7-Hexahydro-N,alpha-Dimethyl-S-Indacene-4-Ethanamine Hydrochloride |