|
CAS#: 828931-67-5 Product: 1-Methyl-2-phenyl-2,3-dihydro-1H-imidazo[1,2-a]imidazole-5,6-dione No suppilers available for the product. |
| Name | 1-Methyl-2-phenyl-2,3-dihydro-1H-imidazo[1,2-a]imidazole-5,6-dione |
|---|---|
| Synonyms | 1H-Imidaz |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.23 |
| CAS Registry Number | 828931-67-5 |
| SMILES | CN1C(CN2C1=NC(=O)C2=O)c3ccccc3 |
| InChI | 1S/C12H11N3O2/c1-14-9(8-5-3-2-4-6-8)7-15-11(17)10(16)13-12(14)15/h2-6,9H,7H2,1H3 |
| InChIKey | KKHBXODHNBZOKE-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 167.6±28.7°C (Cal.) |
| Refractive index | 1.711 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-phenyl-2,3-dihydro-1H-imidazo[1,2-a]imidazole-5,6-dione |