|
CAS#: 82982-73-8 Product: 3-Methenylthiochroman-4-One-1,1-Dioxide No suppilers available for the product. |
| Name | 3-Methenylthiochroman-4-One-1,1-Dioxide |
|---|---|
| Synonyms | 3-Methylene-1,1-Dioxo-Thiochromen-4-One; 3-Methylene-1,1-Dioxo-4-Thiochromenone; 1,1-Diketo-3-Methylene-Thiochromen-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8O3S |
| Molecular Weight | 208.23 |
| CAS Registry Number | 82982-73-8 |
| SMILES | C2=C1[S](=O)(=O)CC(C(=O)C1=CC=C2)=C |
| InChI | 1S/C10H8O3S/c1-7-6-14(12,13)9-5-3-2-4-8(9)10(7)11/h2-5H,1,6H2 |
| InChIKey | PFWVMFGJGJSGBU-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.059°C at 760 mmHg (Cal.) |
| Flash point | 297.693°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methenylthiochroman-4-One-1,1-Dioxide |