|
CAS#: 83-14-7 Product: Pellotine No suppilers available for the product. |
| Name | Pellotine |
|---|---|
| Synonyms | (-)-Pellotine; C09604; Pellotine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 |
| CAS Registry Number | 83-14-7 |
| SMILES | [C@@H]1(N(CCC2=CC(=C(OC)C(=C12)O)OC)C)C |
| InChI | 1S/C13H19NO3/c1-8-11-9(5-6-14(8)2)7-10(16-3)13(17-4)12(11)15/h7-8,15H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | NKHMWHLJHODBEP-MRVPVSSYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.749°C at 760 mmHg (Cal.) |
| Flash point | 136.898°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pellotine |