|
CAS#: 830319-51-2 Product: Methyl (3E)-2-hydroxy-4-(4-methylphenyl)-3-butenoate No suppilers available for the product. |
| Name | Methyl (3E)-2-hydroxy-4-(4-methylphenyl)-3-butenoate |
|---|---|
| Synonyms | (3E)-2-Hydroxy-4-(4-méthylphényl)-3-buténoate de méthyle; 3-BUTENOI |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 830319-51-2 |
| SMILES | Cc1ccc(cc1)/C=C/C(C(=O)OC)O |
| InChI | 1S/C12H14O3/c1-9-3-5-10(6-4-9)7-8-11(13)12(14)15-2/h3-8,11,13H,1-2H3/b8-7+ |
| InChIKey | WDEIXFCPTAVXNT-BQYQJAHWSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.9±30.0°C at 760 mmHg (Cal.) |
| Flash point | 149.6±17.3°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (3E)-2-hydroxy-4-(4-methylphenyl)-3-butenoate |