|
CAS#: 831224-99-8 Product: 4,4-Dimethyl-2-(5-methyl-1-oxaspiro[2.5]oct-2-yl)-4,5-dihydro-1,3-oxazole No suppilers available for the product. |
| Name | 4,4-Dimethyl-2-(5-methyl-1-oxaspiro[2.5]oct-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| Synonyms | 4,4-Dimet |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.31 |
| CAS Registry Number | 831224-99-8 |
| SMILES | CC1CCCC2(C1)C(O2)C3=NC(CO3)(C)C |
| InChI | 1S/C13H21NO2/c1-9-5-4-6-13(7-9)10(16-13)11-14-12(2,3)8-15-11/h9-10H,4-8H2,1-3H3 |
| InChIKey | CSMCYPLHBHIWTR-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.8±35.0°C at 760 mmHg (Cal.) |
| Flash point | 113.5±18.5°C (Cal.) |
| Refractive index | 1.586 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-2-(5-methyl-1-oxaspiro[2.5]oct-2-yl)-4,5-dihydro-1,3-oxazole |